C14H20F2N2 — CID 171164364
1-[(1S)-1-(3,5-difluorophenyl)butyl]piperazine (PubChem CID 171164364) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is 1-[(1S)-1-(3,5-difluorophenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-1-(3,5-difluorophenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171164364 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-[(1S)-1-(3,5-difluorophenyl)butyl]piperazine |
| SMILES | CCC[C@@H](c1cc(F)cc(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C14H20F2N2/c1-2-3-14(18-6-4-17-5-7-18)11-8-12(15)10-13(16)9-11/h8-10,14,17H,2-7H2,1H3/t14-/m0/s1 |
| InChIKey | SIRSAXYARKQMFK-AWEZNQCLSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |