C15H22Cl2F4N2 — CID 171279095
1-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]butyl]piperazine;dihydrochloride (PubChem CID 171279095) has the molecular formula C15H22Cl2F4N2 and a molecular weight of 377.25 g/mol. Its IUPAC name is 1-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279095 |
| Molecular Formula | C15H22Cl2F4N2 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@@H](c1cc(F)cc(C(F)(F)F)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H20F4N2.2ClH/c1-2-3-14(21-6-4-20-5-7-21)11-8-12(15(17,18)19)10-13(16)9-11;;/h8-10,14,20H,2-7H2,1H3;2*1H/t14-;;/m0../s1 |
| InChIKey | QIORVHWXOVDSFC-UTLKBRERSA-N |
| XLogP | 4.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |