C18H24F6N2 — CID 171309861
1-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-4-methylpentyl]piperazine (PubChem CID 171309861) has the molecular formula C18H24F6N2 and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-4-methylpentyl]piperazine.
| Compound Name | 1-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171309861 |
| Molecular Formula | C18H24F6N2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-4-methylpentyl]piperazine |
| SMILES | CC(C)CC[C@@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C18H24F6N2/c1-12(2)3-4-16(26-7-5-25-6-8-26)13-9-14(17(19,20)21)11-15(10-13)18(22,23)24/h9-12,16,25H,3-8H2,1-2H3/t16-/m0/s1 |
| InChIKey | UXZNGSYKDZONHH-INIZCTEOSA-N |
| XLogP | 5.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |