C16H20F6N2O — CID 171174113
(4S)-4-[3,5-bis(trifluoromethyl)phenyl]-4-piperazin-1-ylbutan-1-ol (PubChem CID 171174113) has the molecular formula C16H20F6N2O and a molecular weight of 370.34 g/mol. Its IUPAC name is (4S)-4-[3,5-bis(trifluoromethyl)phenyl]-4-piperazin-1-ylbutan-1-ol.
| Compound Name | (4S)-4-[3,5-bis(trifluoromethyl)phenyl]-4-piperazin-1-ylbutan-1-ol |
|---|---|
| PubChem CID | 171174113 |
| Molecular Formula | C16H20F6N2O |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (4S)-4-[3,5-bis(trifluoromethyl)phenyl]-4-piperazin-1-ylbutan-1-ol |
| SMILES | OCCC[C@@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C16H20F6N2O/c17-15(18,19)12-8-11(9-13(10-12)16(20,21)22)14(2-1-7-25)24-5-3-23-4-6-24/h8-10,14,23,25H,1-7H2/t14-/m0/s1 |
| InChIKey | VVMSVMQDQDLGQH-AWEZNQCLSA-N |
| XLogP | 3.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |