C14H20ClF3N2O — CID 171174457
(4S)-4-piperazin-1-yl-4-(3,4,5-trifluorophenyl)butan-1-ol;hydrochloride (PubChem CID 171174457) has the molecular formula C14H20ClF3N2O and a molecular weight of 324.77 g/mol. Its IUPAC name is (4S)-4-piperazin-1-yl-4-(3,4,5-trifluorophenyl)butan-1-ol;hydrochloride.
| Compound Name | (4S)-4-piperazin-1-yl-4-(3,4,5-trifluorophenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171174457 |
| Molecular Formula | C14H20ClF3N2O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (4S)-4-piperazin-1-yl-4-(3,4,5-trifluorophenyl)butan-1-ol;hydrochloride |
| SMILES | Cl.OCCC[C@@H](c1cc(F)c(F)c(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C14H19F3N2O.ClH/c15-11-8-10(9-12(16)14(11)17)13(2-1-7-20)19-5-3-18-4-6-19;/h8-9,13,18,20H,1-7H2;1H/t13-;/m0./s1 |
| InChIKey | CMMMQMLXDRIMIF-ZOWNYOTGSA-N |
| XLogP | 2.24 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|