C13H19Cl2F3N2 — CID 171290631
1-[(1R)-1-(3,4,5-trifluorophenyl)propyl]piperazine;dihydrochloride (PubChem CID 171290631) has the molecular formula C13H19Cl2F3N2 and a molecular weight of 331.21 g/mol. Its IUPAC name is 1-[(1R)-1-(3,4,5-trifluorophenyl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3,4,5-trifluorophenyl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290631 |
| Molecular Formula | C13H19Cl2F3N2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-[(1R)-1-(3,4,5-trifluorophenyl)propyl]piperazine;dihydrochloride |
| SMILES | CC[C@H](c1cc(F)c(F)c(F)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H17F3N2.2ClH/c1-2-12(18-5-3-17-4-6-18)9-7-10(14)13(16)11(15)8-9;;/h7-8,12,17H,2-6H2,1H3;2*1H/t12-;;/m1../s1 |
| InChIKey | IOXDPVNUCUMEEF-CURYUGHLSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|