C13H17ClF4N2 — CID 171172241
1-[(1R)-1-(2,3,5,6-tetrafluorophenyl)propyl]piperazine;hydrochloride (PubChem CID 171172241) has the molecular formula C13H17ClF4N2 and a molecular weight of 312.74 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3,5,6-tetrafluorophenyl)propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(2,3,5,6-tetrafluorophenyl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172241 |
| Molecular Formula | C13H17ClF4N2 |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-[(1R)-1-(2,3,5,6-tetrafluorophenyl)propyl]piperazine;hydrochloride |
| SMILES | CC[C@H](c1c(F)c(F)cc(F)c1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C13H16F4N2.ClH/c1-2-10(19-5-3-18-4-6-19)11-12(16)8(14)7-9(15)13(11)17;/h7,10,18H,2-6H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | QTTYWYZVFBXFGC-HNCPQSOCSA-N |
| XLogP | 3.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|