C13H14ClF7N2 — CID 171172311
1-[(1R)-3,3,3-trifluoro-1-(2,3,5,6-tetrafluorophenyl)propyl]piperazine;hydrochloride (PubChem CID 171172311) has the molecular formula C13H14ClF7N2 and a molecular weight of 366.71 g/mol. Its IUPAC name is 1-[(1R)-3,3,3-trifluoro-1-(2,3,5,6-tetrafluorophenyl)propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-3,3,3-trifluoro-1-(2,3,5,6-tetrafluorophenyl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172311 |
| Molecular Formula | C13H14ClF7N2 |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-[(1R)-3,3,3-trifluoro-1-(2,3,5,6-tetrafluorophenyl)propyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1cc(F)c(F)c([C@@H](CC(F)(F)F)N2CCNCC2)c1F |
| InChI | InChI=1S/C13H13F7N2.ClH/c14-7-5-8(15)12(17)10(11(7)16)9(6-13(18,19)20)22-3-1-21-2-4-22;/h5,9,21H,1-4,6H2;1H/t9-;/m1./s1 |
| InChIKey | PJTJZQOIWVJHFS-SBSPUUFOSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|