C14H18F4N2 — CID 171167033
1-[(1S)-1-(2,3,5,6-tetrafluorophenyl)butyl]piperazine (PubChem CID 171167033) has the molecular formula C14H18F4N2 and a molecular weight of 290.30 g/mol. Its IUPAC name is 1-[(1S)-1-(2,3,5,6-tetrafluorophenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,3,5,6-tetrafluorophenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171167033 |
| Molecular Formula | C14H18F4N2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[(1S)-1-(2,3,5,6-tetrafluorophenyl)butyl]piperazine |
| SMILES | CCC[C@@H](c1c(F)c(F)cc(F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C14H18F4N2/c1-2-3-11(20-6-4-19-5-7-20)12-13(17)9(15)8-10(16)14(12)18/h8,11,19H,2-7H2,1H3/t11-/m0/s1 |
| InChIKey | LQXUAWUMBVWLPE-NSHDSACASA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|