C15H23ClF2N2 — CID 171171970
1-[(1R)-1-(2,6-difluoro-3-methylphenyl)butyl]piperazine;hydrochloride (PubChem CID 171171970) has the molecular formula C15H23ClF2N2 and a molecular weight of 304.81 g/mol. Its IUPAC name is 1-[(1R)-1-(2,6-difluoro-3-methylphenyl)butyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(2,6-difluoro-3-methylphenyl)butyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171171970 |
| Molecular Formula | C15H23ClF2N2 |
| Molecular Weight | 304.81 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[(1R)-1-(2,6-difluoro-3-methylphenyl)butyl]piperazine;hydrochloride |
| SMILES | CCC[C@H](c1c(F)ccc(C)c1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H22F2N2.ClH/c1-3-4-13(19-9-7-18-8-10-19)14-12(16)6-5-11(2)15(14)17;/h5-6,13,18H,3-4,7-10H2,1-2H3;1H/t13-;/m1./s1 |
| InChIKey | GPUFVHHPAZQFBM-BTQNPOSSSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |