C14H18ClF5N2 — CID 171172161
1-[(1R)-1-(2,3,4,5,6-pentafluorophenyl)butyl]piperazine;hydrochloride (PubChem CID 171172161) has the molecular formula C14H18ClF5N2 and a molecular weight of 344.76 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3,4,5,6-pentafluorophenyl)butyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(2,3,4,5,6-pentafluorophenyl)butyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172161 |
| Molecular Formula | C14H18ClF5N2 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[(1R)-1-(2,3,4,5,6-pentafluorophenyl)butyl]piperazine;hydrochloride |
| SMILES | CCC[C@H](c1c(F)c(F)c(F)c(F)c1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H17F5N2.ClH/c1-2-3-8(21-6-4-20-5-7-21)9-10(15)12(17)14(19)13(18)11(9)16;/h8,20H,2-7H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | MRDPNUYBFOOKKL-DDWIOCJRSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|