C13H12F8N2 — CID 171172120
1-[(1R)-3,3,3-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)propyl]piperazine (PubChem CID 171172120) has the molecular formula C13H12F8N2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 1-[(1R)-3,3,3-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)propyl]piperazine.
| Compound Name | 1-[(1R)-3,3,3-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)propyl]piperazine |
|---|---|
| PubChem CID | 171172120 |
| Molecular Formula | C13H12F8N2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-[(1R)-3,3,3-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)propyl]piperazine |
| SMILES | Fc1c(F)c(F)c([C@@H](CC(F)(F)F)N2CCNCC2)c(F)c1F |
| InChI | InChI=1S/C13H12F8N2/c14-8-7(9(15)11(17)12(18)10(8)16)6(5-13(19,20)21)23-3-1-22-2-4-23/h6,22H,1-5H2/t6-/m1/s1 |
| InChIKey | FYLQZDCOWMRBBO-ZCFIWIBFSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|