C15H17F5N2 — CID 171166805
1-[(1S)-2-cyclopropyl-1-(2,3,4,5,6-pentafluorophenyl)ethyl]piperazine (PubChem CID 171166805) has the molecular formula C15H17F5N2 and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-[(1S)-2-cyclopropyl-1-(2,3,4,5,6-pentafluorophenyl)ethyl]piperazine.
| Compound Name | 1-[(1S)-2-cyclopropyl-1-(2,3,4,5,6-pentafluorophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 171166805 |
| Molecular Formula | C15H17F5N2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[(1S)-2-cyclopropyl-1-(2,3,4,5,6-pentafluorophenyl)ethyl]piperazine |
| SMILES | Fc1c(F)c(F)c([C@H](CC2CC2)N2CCNCC2)c(F)c1F |
| InChI | InChI=1S/C15H17F5N2/c16-11-10(12(17)14(19)15(20)13(11)18)9(7-8-1-2-8)22-5-3-21-4-6-22/h8-9,21H,1-7H2/t9-/m0/s1 |
| InChIKey | ILMAGCAXTDVLNW-VIFPVBQESA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|