C15H21Cl4FN2 — CID 171283788
1-[(1S)-2-cyclopropyl-1-(3,6-dichloro-2-fluorophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171283788) has the molecular formula C15H21Cl4FN2 and a molecular weight of 390.16 g/mol. Its IUPAC name is 1-[(1S)-2-cyclopropyl-1-(3,6-dichloro-2-fluorophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2-cyclopropyl-1-(3,6-dichloro-2-fluorophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171283788 |
| Molecular Formula | C15H21Cl4FN2 |
| Molecular Weight | 390.16 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1-[(1S)-2-cyclopropyl-1-(3,6-dichloro-2-fluorophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1c(Cl)ccc(Cl)c1[C@H](CC1CC1)N1CCNCC1 |
| InChI | InChI=1S/C15H19Cl2FN2.2ClH/c16-11-3-4-12(17)15(18)14(11)13(9-10-1-2-10)20-7-5-19-6-8-20;;/h3-4,10,13,19H,1-2,5-9H2;2*1H/t13-;;/m0../s1 |
| InChIKey | QLPPSANWQHKWCA-GXKRWWSZSA-N |
| XLogP | 4.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|