C15H20Cl2N2 — CID 171284986
1-[(1R)-2-cyclopropyl-1-(2,6-dichlorophenyl)ethyl]piperazine (PubChem CID 171284986) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.24 g/mol. Its IUPAC name is 1-[(1R)-2-cyclopropyl-1-(2,6-dichlorophenyl)ethyl]piperazine.
| Compound Name | 1-[(1R)-2-cyclopropyl-1-(2,6-dichlorophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 171284986 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[(1R)-2-cyclopropyl-1-(2,6-dichlorophenyl)ethyl]piperazine |
| SMILES | Clc1cccc(Cl)c1[C@@H](CC1CC1)N1CCNCC1 |
| InChI | InChI=1S/C15H20Cl2N2/c16-12-2-1-3-13(17)15(12)14(10-11-4-5-11)19-8-6-18-7-9-19/h1-3,11,14,18H,4-10H2/t14-/m1/s1 |
| InChIKey | ISPSJKLQNJGNSU-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |