C13H17Cl2FN2 — CID 171162697
1-[(1S)-1-(2,6-dichlorophenyl)-3-fluoropropyl]piperazine (PubChem CID 171162697) has the molecular formula C13H17Cl2FN2 and a molecular weight of 291.20 g/mol. Its IUPAC name is 1-[(1S)-1-(2,6-dichlorophenyl)-3-fluoropropyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,6-dichlorophenyl)-3-fluoropropyl]piperazine |
|---|---|
| PubChem CID | 171162697 |
| Molecular Formula | C13H17Cl2FN2 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-[(1S)-1-(2,6-dichlorophenyl)-3-fluoropropyl]piperazine |
| SMILES | FCC[C@@H](c1c(Cl)cccc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H17Cl2FN2/c14-10-2-1-3-11(15)13(10)12(4-5-16)18-8-6-17-7-9-18/h1-3,12,17H,4-9H2/t12-/m0/s1 |
| InChIKey | PSEAMXTVWBCYKY-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |