C13H17ClF4N2 — CID 171170090
1-[(1R)-3-fluoro-1-(2,3,6-trifluorophenyl)propyl]piperazine;hydrochloride (PubChem CID 171170090) has the molecular formula C13H17ClF4N2 and a molecular weight of 312.74 g/mol. Its IUPAC name is 1-[(1R)-3-fluoro-1-(2,3,6-trifluorophenyl)propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-3-fluoro-1-(2,3,6-trifluorophenyl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171170090 |
| Molecular Formula | C13H17ClF4N2 |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-[(1R)-3-fluoro-1-(2,3,6-trifluorophenyl)propyl]piperazine;hydrochloride |
| SMILES | Cl.FCC[C@H](c1c(F)ccc(F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C13H16F4N2.ClH/c14-4-3-11(19-7-5-18-6-8-19)12-9(15)1-2-10(16)13(12)17;/h1-2,11,18H,3-8H2;1H/t11-;/m1./s1 |
| InChIKey | IYIPRLJKBAHAMQ-RFVHGSKJSA-N |
| XLogP | 2.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|