C13H16F4N2 — CID 171169905
1-[(1R)-3-fluoro-1-(2,4,6-trifluorophenyl)propyl]piperazine (PubChem CID 171169905) has the molecular formula C13H16F4N2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-[(1R)-3-fluoro-1-(2,4,6-trifluorophenyl)propyl]piperazine.
| Compound Name | 1-[(1R)-3-fluoro-1-(2,4,6-trifluorophenyl)propyl]piperazine |
|---|---|
| PubChem CID | 171169905 |
| Molecular Formula | C13H16F4N2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-[(1R)-3-fluoro-1-(2,4,6-trifluorophenyl)propyl]piperazine |
| SMILES | FCC[C@H](c1c(F)cc(F)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C13H16F4N2/c14-2-1-12(19-5-3-18-4-6-19)13-10(16)7-9(15)8-11(13)17/h7-8,12,18H,1-6H2/t12-/m1/s1 |
| InChIKey | UMCYXTICJYTZNV-GFCCVEGCSA-N |
| XLogP | 2.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |