C14H18ClF3N2 — CID 171164612
1-[(1S)-1-(2,4,6-trifluorophenyl)but-3-enyl]piperazine;hydrochloride (PubChem CID 171164612) has the molecular formula C14H18ClF3N2 and a molecular weight of 306.76 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4,6-trifluorophenyl)but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2,4,6-trifluorophenyl)but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171164612 |
| Molecular Formula | C14H18ClF3N2 |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[(1S)-1-(2,4,6-trifluorophenyl)but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@@H](c1c(F)cc(F)cc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H17F3N2.ClH/c1-2-3-13(19-6-4-18-5-7-19)14-11(16)8-10(15)9-12(14)17;/h2,8-9,13,18H,1,3-7H2;1H/t13-;/m0./s1 |
| InChIKey | WOOTXMVSYMSWJO-ZOWNYOTGSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|