C14H20Cl2F2N2O — CID 171297648
3,5-difluoro-2-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride (PubChem CID 171297648) has the molecular formula C14H20Cl2F2N2O and a molecular weight of 341.23 g/mol. Its IUPAC name is 3,5-difluoro-2-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride.
| Compound Name | 3,5-difluoro-2-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171297648 |
| Molecular Formula | C14H20Cl2F2N2O |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3,5-difluoro-2-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
| SMILES | C=CC[C@@H](c1c(O)cc(F)cc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H18F2N2O.2ClH/c1-2-3-12(18-6-4-17-5-7-18)14-11(16)8-10(15)9-13(14)19;;/h2,8-9,12,17,19H,1,3-7H2;2*1H/t12-;;/m0../s1 |
| InChIKey | WOVHUJVLVSHAGJ-LTCKWSDVSA-N |
| XLogP | 3.04 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|