C15H20F2N2O — CID 171297673
3,5-difluoro-2-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]phenol (PubChem CID 171297673) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 3,5-difluoro-2-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]phenol.
| Compound Name | 3,5-difluoro-2-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]phenol |
|---|---|
| PubChem CID | 171297673 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3,5-difluoro-2-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]phenol |
| SMILES | C=C(C)C[C@@H](c1c(O)cc(F)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C15H20F2N2O/c1-10(2)7-13(19-5-3-18-4-6-19)15-12(17)8-11(16)9-14(15)20/h8-9,13,18,20H,1,3-7H2,2H3/t13-/m0/s1 |
| InChIKey | ZIJHUOGEEHOJOX-ZDUSSCGKSA-N |
| XLogP | 2.58 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|