C15H24Cl2N2O2 — CID 171273875
5-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]benzene-1,3-diol;dihydrochloride (PubChem CID 171273875) has the molecular formula C15H24Cl2N2O2 and a molecular weight of 335.28 g/mol. Its IUPAC name is 5-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]benzene-1,3-diol;dihydrochloride.
| Compound Name | 5-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]benzene-1,3-diol;dihydrochloride |
|---|---|
| PubChem CID | 171273875 |
| Molecular Formula | C15H24Cl2N2O2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]benzene-1,3-diol;dihydrochloride |
| SMILES | C=C(C)C[C@@H](c1cc(O)cc(O)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H22N2O2.2ClH/c1-11(2)7-15(17-5-3-16-4-6-17)12-8-13(18)10-14(19)9-12;;/h8-10,15-16,18-19H,1,3-7H2,2H3;2*1H/t15-;;/m0../s1 |
| InChIKey | ZXRPQSJKPCODGM-CKUXDGONSA-N |
| XLogP | 2.85 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|