C15H24Cl2N2 — CID 171282917
1-[(1S)-3-methyl-1-phenylbut-3-enyl]piperazine;dihydrochloride (PubChem CID 171282917) has the molecular formula C15H24Cl2N2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 1-[(1S)-3-methyl-1-phenylbut-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-3-methyl-1-phenylbut-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171282917 |
| Molecular Formula | C15H24Cl2N2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[(1S)-3-methyl-1-phenylbut-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@@H](c1ccccc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H22N2.2ClH/c1-13(2)12-15(14-6-4-3-5-7-14)17-10-8-16-9-11-17;;/h3-7,15-16H,1,8-12H2,2H3;2*1H/t15-;;/m0../s1 |
| InChIKey | DHPVAPSMZGIOPU-CKUXDGONSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|