C19H33Cl2N3 — CID 171279375
N,N-diethyl-4-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]aniline;dihydrochloride (PubChem CID 171279375) has the molecular formula C19H33Cl2N3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N,N-diethyl-4-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]aniline;dihydrochloride.
| Compound Name | N,N-diethyl-4-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171279375 |
| Molecular Formula | C19H33Cl2N3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | N,N-diethyl-4-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]aniline;dihydrochloride |
| SMILES | C=C(C)C[C@@H](c1ccc(N(CC)CC)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C19H31N3.2ClH/c1-5-21(6-2)18-9-7-17(8-10-18)19(15-16(3)4)22-13-11-20-12-14-22;;/h7-10,19-20H,3,5-6,11-15H2,1-2,4H3;2*1H/t19-;;/m0../s1 |
| InChIKey | XEIUYQBUCPDLHZ-TXEPZDRESA-N |
| XLogP | 4.29 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|