C20H35N3 — CID 171309273
N,N-diethyl-4-[(1S)-1-piperazin-1-ylhexyl]aniline (PubChem CID 171309273) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is N,N-diethyl-4-[(1S)-1-piperazin-1-ylhexyl]aniline.
| Compound Name | N,N-diethyl-4-[(1S)-1-piperazin-1-ylhexyl]aniline |
|---|---|
| PubChem CID | 171309273 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | N,N-diethyl-4-[(1S)-1-piperazin-1-ylhexyl]aniline |
| SMILES | CCCCC[C@@H](c1ccc(N(CC)CC)cc1)N1CCNCC1 |
| InChI | InChI=1S/C20H35N3/c1-4-7-8-9-20(23-16-14-21-15-17-23)18-10-12-19(13-11-18)22(5-2)6-3/h10-13,20-21H,4-9,14-17H2,1-3H3/t20-/m0/s1 |
| InChIKey | QLSHAPVTEARCPG-FQEVSTJZSA-N |
| XLogP | 4.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|