C17H26F3N3 — CID 171302840
N,N-diethyl-4-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline (PubChem CID 171302840) has the molecular formula C17H26F3N3 and a molecular weight of 329.41 g/mol. Its IUPAC name is N,N-diethyl-4-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline.
| Compound Name | N,N-diethyl-4-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline |
|---|---|
| PubChem CID | 171302840 |
| Molecular Formula | C17H26F3N3 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N,N-diethyl-4-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline |
| SMILES | CCN(CC)c1ccc([C@H](CC(F)(F)F)N2CCNCC2)cc1 |
| InChI | InChI=1S/C17H26F3N3/c1-3-22(4-2)15-7-5-14(6-8-15)16(13-17(18,19)20)23-11-9-21-10-12-23/h5-8,16,21H,3-4,9-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | AJCKRKGEYQWKJU-INIZCTEOSA-N |
| XLogP | 3.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|