C19H31N3 — CID 171279366
4-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-N,N-diethylaniline (PubChem CID 171279366) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is 4-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-N,N-diethylaniline.
| Compound Name | 4-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 171279366 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 4-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc([C@H](CC2CC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C19H31N3/c1-3-21(4-2)18-9-7-17(8-10-18)19(15-16-5-6-16)22-13-11-20-12-14-22/h7-10,16,19-20H,3-6,11-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | VJKSEEGDVRIGHX-IBGZPJMESA-N |
| XLogP | 3.28 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|