C19H33Cl2N3O — CID 171272322
2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-5-(diethylamino)phenol;dihydrochloride (PubChem CID 171272322) has the molecular formula C19H33Cl2N3O and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-5-(diethylamino)phenol;dihydrochloride.
| Compound Name | 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-5-(diethylamino)phenol;dihydrochloride |
|---|---|
| PubChem CID | 171272322 |
| Molecular Formula | C19H33Cl2N3O |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-5-(diethylamino)phenol;dihydrochloride |
| SMILES | CCN(CC)c1ccc([C@H](CC2CC2)N2CCNCC2)c(O)c1.Cl.Cl |
| InChI | InChI=1S/C19H31N3O.2ClH/c1-3-21(4-2)16-7-8-17(19(23)14-16)18(13-15-5-6-15)22-11-9-20-10-12-22;;/h7-8,14-15,18,20,23H,3-6,9-13H2,1-2H3;2*1H/t18-;;/m0../s1 |
| InChIKey | CJXMXRVIVLOIOL-NTEVMMBTSA-N |
| XLogP | 3.83 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|