C18H30Cl2F3N3O — CID 171302291
5-(diethylamino)-2-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride (PubChem CID 171302291) has the molecular formula C18H30Cl2F3N3O and a molecular weight of 432.36 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride.
| Compound Name | 5-(diethylamino)-2-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171302291 |
| Molecular Formula | C18H30Cl2F3N3O |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 5-(diethylamino)-2-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
| SMILES | CCN(CC)c1ccc([C@H](CCC(F)(F)F)N2CCNCC2)c(O)c1.Cl.Cl |
| InChI | InChI=1S/C18H28F3N3O.2ClH/c1-3-23(4-2)14-5-6-15(17(25)13-14)16(7-8-18(19,20)21)24-11-9-22-10-12-24;;/h5-6,13,16,22,25H,3-4,7-12H2,1-2H3;2*1H/t16-;;/m0../s1 |
| InChIKey | KHXFGAAJOLUSHL-SQKCAUCHSA-N |
| XLogP | 4.37 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|