C20H37Cl2N3O — CID 171310598
5-(diethylamino)-2-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenol;dihydrochloride (PubChem CID 171310598) has the molecular formula C20H37Cl2N3O and a molecular weight of 406.44 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenol;dihydrochloride.
| Compound Name | 5-(diethylamino)-2-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171310598 |
| Molecular Formula | C20H37Cl2N3O |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 5-(diethylamino)-2-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenol;dihydrochloride |
| SMILES | CCN(CC)c1ccc([C@@H](CCC(C)C)N2CCNCC2)c(O)c1.Cl.Cl |
| InChI | InChI=1S/C20H35N3O.2ClH/c1-5-22(6-2)17-8-9-18(20(24)15-17)19(10-7-16(3)4)23-13-11-21-12-14-23;;/h8-9,15-16,19,21,24H,5-7,10-14H2,1-4H3;2*1H/t19-;;/m1../s1 |
| InChIKey | VLFARJMAVPCRAL-JQDLGSOUSA-N |
| XLogP | 4.46 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|