C15H26Cl2N2O2 — CID 171308726
4-[(1S)-1-piperazin-1-ylpentyl]benzene-1,3-diol;dihydrochloride (PubChem CID 171308726) has the molecular formula C15H26Cl2N2O2 and a molecular weight of 337.29 g/mol. Its IUPAC name is 4-[(1S)-1-piperazin-1-ylpentyl]benzene-1,3-diol;dihydrochloride.
| Compound Name | 4-[(1S)-1-piperazin-1-ylpentyl]benzene-1,3-diol;dihydrochloride |
|---|---|
| PubChem CID | 171308726 |
| Molecular Formula | C15H26Cl2N2O2 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[(1S)-1-piperazin-1-ylpentyl]benzene-1,3-diol;dihydrochloride |
| SMILES | CCCC[C@@H](c1ccc(O)cc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H24N2O2.2ClH/c1-2-3-4-14(17-9-7-16-8-10-17)13-6-5-12(18)11-15(13)19;;/h5-6,11,14,16,18-19H,2-4,7-10H2,1H3;2*1H/t14-;;/m0../s1 |
| InChIKey | UZYPJTHMYBIZCR-UTLKBRERSA-N |
| XLogP | 3.08 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|