C16H28Cl2N2O — CID 171307505
2-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride (PubChem CID 171307505) has the molecular formula C16H28Cl2N2O and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride.
| Compound Name | 2-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171307505 |
| Molecular Formula | C16H28Cl2N2O |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
| SMILES | CCCCC[C@H](c1ccccc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H26N2O.2ClH/c1-2-3-4-8-15(18-12-10-17-11-13-18)14-7-5-6-9-16(14)19;;/h5-7,9,15,17,19H,2-4,8,10-13H2,1H3;2*1H/t15-;;/m1../s1 |
| InChIKey | FQXCXZIZMVGERY-QCUBGVIVSA-N |
| XLogP | 3.76 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|