C17H30Cl2N2O2 — CID 171307637
4-methoxy-2-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride (PubChem CID 171307637) has the molecular formula C17H30Cl2N2O2 and a molecular weight of 365.35 g/mol. Its IUPAC name is 4-methoxy-2-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride.
| Compound Name | 4-methoxy-2-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171307637 |
| Molecular Formula | C17H30Cl2N2O2 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-methoxy-2-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
| SMILES | CCCCC[C@H](c1cc(OC)ccc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H28N2O2.2ClH/c1-3-4-5-6-16(19-11-9-18-10-12-19)15-13-14(21-2)7-8-17(15)20;;/h7-8,13,16,18,20H,3-6,9-12H2,1-2H3;2*1H/t16-;;/m1../s1 |
| InChIKey | GZFQMUCTVGIKPG-GGMCWBHBSA-N |
| XLogP | 3.77 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|