C18H27F3N2O — CID 171171020
1-[(1R)-1-[4-methoxy-2-(trifluoromethyl)phenyl]hexyl]piperazine (PubChem CID 171171020) has the molecular formula C18H27F3N2O and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[(1R)-1-[4-methoxy-2-(trifluoromethyl)phenyl]hexyl]piperazine.
| Compound Name | 1-[(1R)-1-[4-methoxy-2-(trifluoromethyl)phenyl]hexyl]piperazine |
|---|---|
| PubChem CID | 171171020 |
| Molecular Formula | C18H27F3N2O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[(1R)-1-[4-methoxy-2-(trifluoromethyl)phenyl]hexyl]piperazine |
| SMILES | CCCCC[C@H](c1ccc(OC)cc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C18H27F3N2O/c1-3-4-5-6-17(23-11-9-22-10-12-23)15-8-7-14(24-2)13-16(15)18(19,20)21/h7-8,13,17,22H,3-6,9-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | FHYOGHXCHOARJA-QGZVFWFLSA-N |
| XLogP | 4.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|