C17H24ClF3N2 — CID 171165361
1-[(1S)-1-[4-chloro-2-(trifluoromethyl)phenyl]hexyl]piperazine (PubChem CID 171165361) has the molecular formula C17H24ClF3N2 and a molecular weight of 348.84 g/mol. Its IUPAC name is 1-[(1S)-1-[4-chloro-2-(trifluoromethyl)phenyl]hexyl]piperazine.
| Compound Name | 1-[(1S)-1-[4-chloro-2-(trifluoromethyl)phenyl]hexyl]piperazine |
|---|---|
| PubChem CID | 171165361 |
| Molecular Formula | C17H24ClF3N2 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(1S)-1-[4-chloro-2-(trifluoromethyl)phenyl]hexyl]piperazine |
| SMILES | CCCCC[C@@H](c1ccc(Cl)cc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C17H24ClF3N2/c1-2-3-4-5-16(23-10-8-22-9-11-23)14-7-6-13(18)12-15(14)17(19,20)21/h6-7,12,16,22H,2-5,8-11H2,1H3/t16-/m0/s1 |
| InChIKey | MBWFVCAMNBHVQC-INIZCTEOSA-N |
| XLogP | 4.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|