C17H29Cl2FN2O — CID 171308046
1-[(1R)-1-(2-fluoro-5-methoxyphenyl)hexyl]piperazine;dihydrochloride (PubChem CID 171308046) has the molecular formula C17H29Cl2FN2O and a molecular weight of 367.34 g/mol. Its IUPAC name is 1-[(1R)-1-(2-fluoro-5-methoxyphenyl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-fluoro-5-methoxyphenyl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308046 |
| Molecular Formula | C17H29Cl2FN2O |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[(1R)-1-(2-fluoro-5-methoxyphenyl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@H](c1cc(OC)ccc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H27FN2O.2ClH/c1-3-4-5-6-17(20-11-9-19-10-12-20)15-13-14(21-2)7-8-16(15)18;;/h7-8,13,17,19H,3-6,9-12H2,1-2H3;2*1H/t17-;;/m1../s1 |
| InChIKey | XEYXCXBXCZSTLF-ZEECNFPPSA-N |
| XLogP | 4.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|