C17H27ClF2N2O — CID 171167769
1-[(1S)-1-(2,6-difluoro-4-methoxyphenyl)hexyl]piperazine;hydrochloride (PubChem CID 171167769) has the molecular formula C17H27ClF2N2O and a molecular weight of 348.87 g/mol. Its IUPAC name is 1-[(1S)-1-(2,6-difluoro-4-methoxyphenyl)hexyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2,6-difluoro-4-methoxyphenyl)hexyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167769 |
| Molecular Formula | C17H27ClF2N2O |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[(1S)-1-(2,6-difluoro-4-methoxyphenyl)hexyl]piperazine;hydrochloride |
| SMILES | CCCCC[C@@H](c1c(F)cc(OC)cc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H26F2N2O.ClH/c1-3-4-5-6-16(21-9-7-20-8-10-21)17-14(18)11-13(22-2)12-15(17)19;/h11-12,16,20H,3-10H2,1-2H3;1H/t16-;/m0./s1 |
| InChIKey | HUUBNCICHVLJMF-NTISSMGPSA-N |
| XLogP | 3.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|