C18H26F2N2O — CID 171173093
1-[(1R)-1-(2,6-difluoro-4-methoxyphenyl)hept-6-enyl]piperazine (PubChem CID 171173093) has the molecular formula C18H26F2N2O and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[(1R)-1-(2,6-difluoro-4-methoxyphenyl)hept-6-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,6-difluoro-4-methoxyphenyl)hept-6-enyl]piperazine |
|---|---|
| PubChem CID | 171173093 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-[(1R)-1-(2,6-difluoro-4-methoxyphenyl)hept-6-enyl]piperazine |
| SMILES | C=CCCCC[C@H](c1c(F)cc(OC)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C18H26F2N2O/c1-3-4-5-6-7-17(22-10-8-21-9-11-22)18-15(19)12-14(23-2)13-16(18)20/h3,12-13,17,21H,1,4-11H2,2H3/t17-/m1/s1 |
| InChIKey | JDUXQLAGVUVKOG-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|