C17H23F3N2 — CID 171170071
1-[(1R)-1-(2,3,5-trifluorophenyl)hept-6-enyl]piperazine (PubChem CID 171170071) has the molecular formula C17H23F3N2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3,5-trifluorophenyl)hept-6-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,3,5-trifluorophenyl)hept-6-enyl]piperazine |
|---|---|
| PubChem CID | 171170071 |
| Molecular Formula | C17H23F3N2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-[(1R)-1-(2,3,5-trifluorophenyl)hept-6-enyl]piperazine |
| SMILES | C=CCCCC[C@H](c1cc(F)cc(F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C17H23F3N2/c1-2-3-4-5-6-16(22-9-7-21-8-10-22)14-11-13(18)12-15(19)17(14)20/h2,11-12,16,21H,1,3-10H2/t16-/m1/s1 |
| InChIKey | SPXURJJGBAPHIN-MRXNPFEDSA-N |
| XLogP | 3.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|