C17H25BrClFN2 — CID 171163238
1-[(1S)-1-(5-bromo-2-fluorophenyl)hept-6-enyl]piperazine;hydrochloride (PubChem CID 171163238) has the molecular formula C17H25BrClFN2 and a molecular weight of 391.76 g/mol. Its IUPAC name is 1-[(1S)-1-(5-bromo-2-fluorophenyl)hept-6-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(5-bromo-2-fluorophenyl)hept-6-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171163238 |
| Molecular Formula | C17H25BrClFN2 |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[(1S)-1-(5-bromo-2-fluorophenyl)hept-6-enyl]piperazine;hydrochloride |
| SMILES | C=CCCCC[C@@H](c1cc(Br)ccc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H24BrFN2.ClH/c1-2-3-4-5-6-17(21-11-9-20-10-12-21)15-13-14(18)7-8-16(15)19;/h2,7-8,13,17,20H,1,3-6,9-12H2;1H/t17-;/m0./s1 |
| InChIKey | IGZZKBBFTQTTBU-LMOVPXPDSA-N |
| XLogP | 4.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|