C17H25FN2O — CID 171162781
2-fluoro-6-[(1S)-1-piperazin-1-ylhept-6-enyl]phenol (PubChem CID 171162781) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-fluoro-6-[(1S)-1-piperazin-1-ylhept-6-enyl]phenol.
| Compound Name | 2-fluoro-6-[(1S)-1-piperazin-1-ylhept-6-enyl]phenol |
|---|---|
| PubChem CID | 171162781 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-fluoro-6-[(1S)-1-piperazin-1-ylhept-6-enyl]phenol |
| SMILES | C=CCCCC[C@@H](c1cccc(F)c1O)N1CCNCC1 |
| InChI | InChI=1S/C17H25FN2O/c1-2-3-4-5-9-16(20-12-10-19-11-13-20)14-7-6-8-15(18)17(14)21/h2,6-8,16,19,21H,1,3-5,9-13H2/t16-/m0/s1 |
| InChIKey | SYRRVXPCKWSJIB-INIZCTEOSA-N |
| XLogP | 3.22 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|