C14H22ClFN2O — CID 171162750
2-fluoro-6-[(1S)-1-piperazin-1-ylbutyl]phenol;hydrochloride (PubChem CID 171162750) has the molecular formula C14H22ClFN2O and a molecular weight of 288.79 g/mol. Its IUPAC name is 2-fluoro-6-[(1S)-1-piperazin-1-ylbutyl]phenol;hydrochloride.
| Compound Name | 2-fluoro-6-[(1S)-1-piperazin-1-ylbutyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171162750 |
| Molecular Formula | C14H22ClFN2O |
| Molecular Weight | 288.79 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-fluoro-6-[(1S)-1-piperazin-1-ylbutyl]phenol;hydrochloride |
| SMILES | CCC[C@@H](c1cccc(F)c1O)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H21FN2O.ClH/c1-2-4-13(17-9-7-16-8-10-17)11-5-3-6-12(15)14(11)18;/h3,5-6,13,16,18H,2,4,7-10H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | RYAXHOXJAPBXOG-ZOWNYOTGSA-N |
| XLogP | 2.70 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.79 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|