C14H20F2N2 — CID 171169482
1-[(1R)-1-(2,3-difluorophenyl)butyl]piperazine (PubChem CID 171169482) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3-difluorophenyl)butyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,3-difluorophenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171169482 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-[(1R)-1-(2,3-difluorophenyl)butyl]piperazine |
| SMILES | CCC[C@H](c1cccc(F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C14H20F2N2/c1-2-4-13(18-9-7-17-8-10-18)11-5-3-6-12(15)14(11)16/h3,5-6,13,17H,2,4,7-10H2,1H3/t13-/m1/s1 |
| InChIKey | XKLKEUXMFZFCNW-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |