C15H20F2N2 — CID 171276987
1-[(1S)-1-(2,3-difluorophenyl)pent-4-enyl]piperazine (PubChem CID 171276987) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-[(1S)-1-(2,3-difluorophenyl)pent-4-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,3-difluorophenyl)pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171276987 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[(1S)-1-(2,3-difluorophenyl)pent-4-enyl]piperazine |
| SMILES | C=CCC[C@@H](c1cccc(F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C15H20F2N2/c1-2-3-7-14(19-10-8-18-9-11-19)12-5-4-6-13(16)15(12)17/h2,4-6,14,18H,1,3,7-11H2/t14-/m0/s1 |
| InChIKey | UMMNPQBEWNHUDN-AWEZNQCLSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|