C17H24ClF3N2 — CID 171170272
1-[(1R)-1-(2,3,4-trifluorophenyl)hept-6-enyl]piperazine;hydrochloride (PubChem CID 171170272) has the molecular formula C17H24ClF3N2 and a molecular weight of 348.84 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3,4-trifluorophenyl)hept-6-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(2,3,4-trifluorophenyl)hept-6-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171170272 |
| Molecular Formula | C17H24ClF3N2 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(1R)-1-(2,3,4-trifluorophenyl)hept-6-enyl]piperazine;hydrochloride |
| SMILES | C=CCCCC[C@H](c1ccc(F)c(F)c1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H23F3N2.ClH/c1-2-3-4-5-6-15(22-11-9-21-10-12-22)13-7-8-14(18)17(20)16(13)19;/h2,7-8,15,21H,1,3-6,9-12H2;1H/t15-;/m1./s1 |
| InChIKey | NRSAXVCTSKOUKR-XFULWGLBSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|