C17H25FN2 — CID 171168284
1-[(1R)-1-(4-fluorophenyl)hept-6-enyl]piperazine (PubChem CID 171168284) has the molecular formula C17H25FN2 and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)hept-6-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)hept-6-enyl]piperazine |
|---|---|
| PubChem CID | 171168284 |
| Molecular Formula | C17H25FN2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)hept-6-enyl]piperazine |
| SMILES | C=CCCCC[C@H](c1ccc(F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C17H25FN2/c1-2-3-4-5-6-17(20-13-11-19-12-14-20)15-7-9-16(18)10-8-15/h2,7-10,17,19H,1,3-6,11-14H2/t17-/m1/s1 |
| InChIKey | OSJPBDGPWBOEDH-QGZVFWFLSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|