C17H24F2N2 — CID 171164418
1-[(1S)-1-(3,5-difluorophenyl)hept-6-enyl]piperazine (PubChem CID 171164418) has the molecular formula C17H24F2N2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-[(1S)-1-(3,5-difluorophenyl)hept-6-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(3,5-difluorophenyl)hept-6-enyl]piperazine |
|---|---|
| PubChem CID | 171164418 |
| Molecular Formula | C17H24F2N2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[(1S)-1-(3,5-difluorophenyl)hept-6-enyl]piperazine |
| SMILES | C=CCCCC[C@@H](c1cc(F)cc(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C17H24F2N2/c1-2-3-4-5-6-17(21-9-7-20-8-10-21)14-11-15(18)13-16(19)12-14/h2,11-13,17,20H,1,3-10H2/t17-/m0/s1 |
| InChIKey | ATZAFNINUKVHHJ-KRWDZBQOSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|