C18H24F4N2 — CID 171169252
1-[(1R)-1-[4-fluoro-3-(trifluoromethyl)phenyl]hept-6-enyl]piperazine (PubChem CID 171169252) has the molecular formula C18H24F4N2 and a molecular weight of 344.40 g/mol. Its IUPAC name is 1-[(1R)-1-[4-fluoro-3-(trifluoromethyl)phenyl]hept-6-enyl]piperazine.
| Compound Name | 1-[(1R)-1-[4-fluoro-3-(trifluoromethyl)phenyl]hept-6-enyl]piperazine |
|---|---|
| PubChem CID | 171169252 |
| Molecular Formula | C18H24F4N2 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1-[(1R)-1-[4-fluoro-3-(trifluoromethyl)phenyl]hept-6-enyl]piperazine |
| SMILES | C=CCCCC[C@H](c1ccc(F)c(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C18H24F4N2/c1-2-3-4-5-6-17(24-11-9-23-10-12-24)14-7-8-16(19)15(13-14)18(20,21)22/h2,7-8,13,17,23H,1,3-6,9-12H2/t17-/m1/s1 |
| InChIKey | NYVWNCOPRNSEPG-QGZVFWFLSA-N |
| XLogP | 4.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|