C18H26ClF3N2O — CID 171172097
1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine;hydrochloride (PubChem CID 171172097) has the molecular formula C18H26ClF3N2O and a molecular weight of 378.87 g/mol. Its IUPAC name is 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172097 |
| Molecular Formula | C18H26ClF3N2O |
| Molecular Weight | 378.87 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine;hydrochloride |
| SMILES | C=CCCCC[C@H](c1cccc(OC(F)(F)F)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C18H25F3N2O.ClH/c1-2-3-4-5-9-17(23-12-10-22-11-13-23)15-7-6-8-16(14-15)24-18(19,20)21;/h2,6-8,14,17,22H,1,3-5,9-13H2;1H/t17-;/m1./s1 |
| InChIKey | IDYCUFQJANDEFS-UNTBIKODSA-N |
| XLogP | 4.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|