C17H26ClF3N2O — CID 171172081
1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hexyl]piperazine;hydrochloride (PubChem CID 171172081) has the molecular formula C17H26ClF3N2O and a molecular weight of 366.86 g/mol. Its IUPAC name is 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hexyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hexyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172081 |
| Molecular Formula | C17H26ClF3N2O |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hexyl]piperazine;hydrochloride |
| SMILES | CCCCC[C@H](c1cccc(OC(F)(F)F)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H25F3N2O.ClH/c1-2-3-4-8-16(22-11-9-21-10-12-22)14-6-5-7-15(13-14)23-17(18,19)20;/h5-7,13,16,21H,2-4,8-12H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | MYHDXISLYMYAHV-PKLMIRHRSA-N |
| XLogP | 4.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|